C15H10N2O3 — CID 162788375
1,2-diphenylpyrazolidine-3,4,5-trione (PubChem CID 162788375) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 1,2-diphenylpyrazolidine-3,4,5-trione.
| Compound Name | 1,2-diphenylpyrazolidine-3,4,5-trione |
|---|---|
| PubChem CID | 162788375 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1,2-diphenylpyrazolidine-3,4,5-trione |
| SMILES | O=C1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H10N2O3/c18-13-14(19)16(11-7-3-1-4-8-11)17(15(13)20)12-9-5-2-6-10-12/h1-10H |
| InChIKey | SLHZQUZPZVEWIS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|