C15H13N3O2 — CID 162789664
4-amino-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 162789664) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-amino-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-amino-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 162789664 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-amino-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | NC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H13N3O2/c16-13-14(19)17(11-7-3-1-4-8-11)18(15(13)20)12-9-5-2-6-10-12/h1-10,13H,16H2 |
| InChIKey | UCDGZXKJBADHHC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|