C19H20N2NaO2 — CID 24844231
CID 24844231 (PubChem CID 24844231) has the molecular formula C19H20N2NaO2 and a molecular weight of 331.37 g/mol.
| Compound Name | CID 24844231 |
|---|---|
| PubChem CID | 24844231 |
| Molecular Formula | C19H20N2NaO2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | — |
| SMILES | CC(C)CC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O.[Na] |
| InChI | InChI=1S/C19H20N2O2.Na/c1-14(2)13-17-18(22)20(15-9-5-3-6-10-15)21(19(17)23)16-11-7-4-8-12-16;/h3-12,14,17H,13H2,1-2H3; |
| InChIKey | PASSCHFMKAOCEO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|