C18H18N2O2S — CID 21139704
4-(1-methylsulfanylethyl)-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 21139704) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(1-methylsulfanylethyl)-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-(1-methylsulfanylethyl)-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 21139704 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-(1-methylsulfanylethyl)-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CSC(C)C1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18N2O2S/c1-13(23-2)16-17(21)19(14-9-5-3-6-10-14)20(18(16)22)15-11-7-4-8-12-15/h3-13,16H,1-2H3 |
| InChIKey | GAWWBZVPKZFKOH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|