C35H32N4O4 — CID 162801430
4-[1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-3-methylbutyl]-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 162801430) has the molecular formula C35H32N4O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is 4-[1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-3-methylbutyl]-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-[1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-3-methylbutyl]-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 162801430 |
| Molecular Formula | C35H32N4O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 4-[1-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-3-methylbutyl]-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CC(C)CC(C1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O)C1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C35H32N4O4/c1-24(2)23-29(30-32(40)36(25-15-7-3-8-16-25)37(33(30)41)26-17-9-4-10-18-26)31-34(42)38(27-19-11-5-12-20-27)39(35(31)43)28-21-13-6-14-22-28/h3-22,24,29-31H,23H2,1-2H3 |
| InChIKey | KOERTMXUHDOMQP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|