C17H16N2O2 — CID 117066425
4-methyl-1,2-diphenyldiazinane-3,6-dione (PubChem CID 117066425) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-methyl-1,2-diphenyldiazinane-3,6-dione.
| Compound Name | 4-methyl-1,2-diphenyldiazinane-3,6-dione |
|---|---|
| PubChem CID | 117066425 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-methyl-1,2-diphenyldiazinane-3,6-dione |
| SMILES | CC1CC(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H16N2O2/c1-13-12-16(20)18(14-8-4-2-5-9-14)19(17(13)21)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3 |
| InChIKey | QVCQWARINJXXIC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |