C18H19N2O5P — CID 170912943
4-dimethoxyphosphoryl-1,2-diphenyldiazinane-3,6-dione (PubChem CID 170912943) has the molecular formula C18H19N2O5P and a molecular weight of 374.33 g/mol. Its IUPAC name is 4-dimethoxyphosphoryl-1,2-diphenyldiazinane-3,6-dione.
| Compound Name | 4-dimethoxyphosphoryl-1,2-diphenyldiazinane-3,6-dione |
|---|---|
| PubChem CID | 170912943 |
| Molecular Formula | C18H19N2O5P |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-dimethoxyphosphoryl-1,2-diphenyldiazinane-3,6-dione |
| SMILES | COP(=O)(OC)C1CC(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H19N2O5P/c1-24-26(23,25-2)16-13-17(21)19(14-9-5-3-6-10-14)20(18(16)22)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3 |
| InChIKey | GLKQHBQEDCQSEL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|