C29H25NO8P2 — CID 164746065
3-diphenoxyphosphoryl-1-(diphenoxyphosphorylmethyl)pyrrolidine-2,5-dione (PubChem CID 164746065) has the molecular formula C29H25NO8P2 and a molecular weight of 577.47 g/mol. Its IUPAC name is 3-diphenoxyphosphoryl-1-(diphenoxyphosphorylmethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-diphenoxyphosphoryl-1-(diphenoxyphosphorylmethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 164746065 |
| Molecular Formula | C29H25NO8P2 |
| Molecular Weight | 577.47 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | 3-diphenoxyphosphoryl-1-(diphenoxyphosphorylmethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(P(=O)(Oc2ccccc2)Oc2ccccc2)C(=O)N1CP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C29H25NO8P2/c31-28-21-27(40(34,37-25-17-9-3-10-18-25)38-26-19-11-4-12-20-26)29(32)30(28)22-39(33,35-23-13-5-1-6-14-23)36-24-15-7-2-8-16-24/h1-20,27H,21-22H2 |
| InChIKey | XQXNWEXSEGCGJG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|