C11H13NO5P+ — CID 149294510
[(2,5-dioxopyrrolidin-1-yl)-phenoxyphosphoryl]-methyloxidanium (PubChem CID 149294510) has the molecular formula C11H13NO5P+ and a molecular weight of 270.20 g/mol. Its IUPAC name is [(2,5-dioxopyrrolidin-1-yl)-phenoxyphosphoryl]-methyloxidanium.
| Compound Name | [(2,5-dioxopyrrolidin-1-yl)-phenoxyphosphoryl]-methyloxidanium |
|---|---|
| PubChem CID | 149294510 |
| Molecular Formula | C11H13NO5P+ |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | [(2,5-dioxopyrrolidin-1-yl)-phenoxyphosphoryl]-methyloxidanium |
| SMILES | C[OH+]P(=O)(Oc1ccccc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C11H12NO5P/c1-16-18(15,12-10(13)7-8-11(12)14)17-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3/p+1 |
| InChIKey | XVNATCSLRUSZPL-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 76.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|