About [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate
[methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate (PubChem CID 87979302) has the molecular formula C15H22O8P2
and a molecular weight of 392.28 g/mol. Its IUPAC name is [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate.
Molecular Properties
| Compound Name | [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate |
| PubChem CID | 87979302 |
| Molecular Formula | C15H22O8P2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate |
| SMILES | COP(=O)(CP(=O)(OC)Oc1ccccc1)Oc1ccccc1.O.O |
| InChI | InChI=1S/C15H18O6P2.2H2O/c1-18-22(16,20-14-9-5-3-6-10-14)13-23(17,19-2)21-15-11-7-4-8-12-15;;/h3-12H,13H2,1-2H3;2*1H2 |
| InChIKey | HQBLETJCMIRLGN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 134.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate?
The IUPAC name of [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate (CID 87979302) is [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate.
What is the SMILES notation for [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate?
The canonical SMILES for [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate is COP(=O)(CP(=O)(OC)Oc1ccccc1)Oc1ccccc1.O.O.
What is the InChIKey of [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate?
The InChIKey is HQBLETJCMIRLGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O6P2.2H2O/c1-18-22(16,20-14-9-5-3-6-10-14)13-23(17,19-2)21-15-11-7-4-8-12-15;;/h3-12H,13H2,1-2H3;2*1H2.
What are the key properties of [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate?
[methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate has a molecular weight of 392.28 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [methoxy-[[methoxy(phenoxy)phosphoryl]methyl]phosphoryl]oxybenzene;dihydrate is sourced from PubChem (CID 87979302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).