C11H14NO6P — CID 88709753
2-[formyl-[[methoxy(phenoxy)phosphoryl]methyl]amino]acetic acid (PubChem CID 88709753) has the molecular formula C11H14NO6P and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[formyl-[[methoxy(phenoxy)phosphoryl]methyl]amino]acetic acid.
| Compound Name | 2-[formyl-[[methoxy(phenoxy)phosphoryl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 88709753 |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[formyl-[[methoxy(phenoxy)phosphoryl]methyl]amino]acetic acid |
| SMILES | COP(=O)(CN(C=O)CC(=O)O)Oc1ccccc1 |
| InChI | InChI=1S/C11H14NO6P/c1-17-19(16,9-12(8-13)7-11(14)15)18-10-5-3-2-4-6-10/h2-6,8H,7,9H2,1H3,(H,14,15) |
| InChIKey | LDNPYEMCLUWEQN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|