C10H9NO4 — CID 149252640
1-hydroxy-3-phenoxypyrrolidine-2,5-dione (PubChem CID 149252640) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 1-hydroxy-3-phenoxypyrrolidine-2,5-dione.
| Compound Name | 1-hydroxy-3-phenoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 149252640 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-hydroxy-3-phenoxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(Oc2ccccc2)C(=O)N1O |
| InChI | InChI=1S/C10H9NO4/c12-9-6-8(10(13)11(9)14)15-7-4-2-1-3-5-7/h1-5,8,14H,6H2 |
| InChIKey | RRZPSOOJUGRKCL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|