C11H9NO5 — CID 163747138
[(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 163747138) has the molecular formula C11H9NO5 and a molecular weight of 235.20 g/mol. Its IUPAC name is [(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 163747138 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | [(3R)-1-hydroxy-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1CC(=O)N(O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO5/c13-9-6-8(10(14)12(9)16)17-11(15)7-4-2-1-3-5-7/h1-5,8,16H,6H2/t8-/m1/s1 |
| InChIKey | LMVKTTQOOPBRIW-MRVPVSSYSA-N |
| XLogP | 0.36 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|