C11H9NO4 — CID 155713089
[(3R)-2,5-dioxopyrrolidin-3-yl] benzoate (PubChem CID 155713089) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is [(3R)-2,5-dioxopyrrolidin-3-yl] benzoate.
| Compound Name | [(3R)-2,5-dioxopyrrolidin-3-yl] benzoate |
|---|---|
| PubChem CID | 155713089 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | [(3R)-2,5-dioxopyrrolidin-3-yl] benzoate |
| SMILES | O=C1C[C@@H](OC(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H9NO4/c13-9-6-8(10(14)12-9)16-11(15)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,12,13,14)/t8-/m1/s1 |
| InChIKey | CPQJLXRWJZSTGP-MRVPVSSYSA-N |
| XLogP | 0.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|