C14H11NO6 — CID 122480500
1-O-(2,5-dioxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate (PubChem CID 122480500) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is 1-O-(2,5-dioxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate.
| Compound Name | 1-O-(2,5-dioxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122480500 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-O-(2,5-dioxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate |
| SMILES | O=C1CC(OC(=O)/C=C/C(=O)Oc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C14H11NO6/c16-11-8-10(14(19)15-11)21-13(18)7-6-12(17)20-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,15,16,19)/b7-6+ |
| InChIKey | UELQAPFDLJGZQI-VOTSOKGWSA-N |
| XLogP | 0.11 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|