C15H13NO5 — CID 122487342
1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate (PubChem CID 122487342) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate.
| Compound Name | 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122487342 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-O-(5-methylidene-2-oxopyrrolidin-3-yl) 4-O-phenyl (E)-but-2-enedioate |
| SMILES | C=C1CC(OC(=O)/C=C/C(=O)Oc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C15H13NO5/c1-10-9-12(15(19)16-10)21-14(18)8-7-13(17)20-11-5-3-2-4-6-11/h2-8,12H,1,9H2,(H,16,19)/b8-7+ |
| InChIKey | UVTVMDQGETXXSE-BQYQJAHWSA-N |
| XLogP | 1.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|