C11H12N2O3 — CID 143609407
1,3-dimethyl-5-phenoxyimidazolidine-2,4-dione (PubChem CID 143609407) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1,3-dimethyl-5-phenoxyimidazolidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-phenoxyimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143609407 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,3-dimethyl-5-phenoxyimidazolidine-2,4-dione |
| SMILES | CN1C(=O)C(Oc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C11H12N2O3/c1-12-9(14)10(13(2)11(12)15)16-8-6-4-3-5-7-8/h3-7,10H,1-2H3 |
| InChIKey | ONUPIVJCHHCKBK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|