C17H21N5O3 — CID 131921503
5-[[2-ethyl-5-(phenoxymethyl)-1,2,4-triazol-3-yl]methyl]-1,3-dimethylimidazolidine-2,4-dione (PubChem CID 131921503) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 5-[[2-ethyl-5-(phenoxymethyl)-1,2,4-triazol-3-yl]methyl]-1,3-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[[2-ethyl-5-(phenoxymethyl)-1,2,4-triazol-3-yl]methyl]-1,3-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131921503 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 5-[[2-ethyl-5-(phenoxymethyl)-1,2,4-triazol-3-yl]methyl]-1,3-dimethylimidazolidine-2,4-dione |
| SMILES | CCn1nc(COc2ccccc2)nc1CC1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C17H21N5O3/c1-4-22-15(10-13-16(23)21(3)17(24)20(13)2)18-14(19-22)11-25-12-8-6-5-7-9-12/h5-9,13H,4,10-11H2,1-3H3 |
| InChIKey | XCTPWYHQVFBQKC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|