C17H16NO3P — CID 175507545
3-diphenylphosphoryl-1-methylpyrrolidine-2,5-dione (PubChem CID 175507545) has the molecular formula C17H16NO3P and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-diphenylphosphoryl-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-diphenylphosphoryl-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175507545 |
| Molecular Formula | C17H16NO3P |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-diphenylphosphoryl-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(P(=O)(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C17H16NO3P/c1-18-16(19)12-15(17(18)20)22(21,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3 |
| InChIKey | UPJPHTUQFQRFBL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|