C11H12N2O2S — CID 14956141
3-(2-aminophenyl)sulfanyl-1-methylpyrrolidine-2,5-dione (PubChem CID 14956141) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-(2-aminophenyl)sulfanyl-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-aminophenyl)sulfanyl-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 14956141 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(2-aminophenyl)sulfanyl-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Sc2ccccc2N)C1=O |
| InChI | InChI=1S/C11H12N2O2S/c1-13-10(14)6-9(11(13)15)16-8-5-3-2-4-7(8)12/h2-5,9H,6,12H2,1H3 |
| InChIKey | FFCWXTIUKUELNW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|