C16H11F3N2O2S — CID 6977579
(3R)-3-(2-aminophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)pyrrolidine-2,5-dione (PubChem CID 6977579) has the molecular formula C16H11F3N2O2S and a molecular weight of 352.34 g/mol. Its IUPAC name is (3R)-3-(2-aminophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-aminophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6977579 |
| Molecular Formula | C16H11F3N2O2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (3R)-3-(2-aminophenyl)sulfanyl-1-(2,3,4-trifluorophenyl)pyrrolidine-2,5-dione |
| SMILES | Nc1ccccc1S[C@@H]1CC(=O)N(c2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C16H11F3N2O2S/c17-8-5-6-10(15(19)14(8)18)21-13(22)7-12(16(21)23)24-11-4-2-1-3-9(11)20/h1-6,12H,7,20H2/t12-/m1/s1 |
| InChIKey | CWSBGIJJFFBJPP-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|