C19H20N2O2S — CID 98541204
(3S)-3-(2-aminophenyl)sulfanyl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione (PubChem CID 98541204) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3S)-3-(2-aminophenyl)sulfanyl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98541204 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3S)-3-(2-aminophenyl)sulfanyl-1-(2-propan-2-ylphenyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)c1ccccc1N1C(=O)C[C@H](Sc2ccccc2N)C1=O |
| InChI | InChI=1S/C19H20N2O2S/c1-12(2)13-7-3-5-9-15(13)21-18(22)11-17(19(21)23)24-16-10-6-4-8-14(16)20/h3-10,12,17H,11,20H2,1-2H3/t17-/m0/s1 |
| InChIKey | QZZVWERGPREWKI-KRWDZBQOSA-N |
| XLogP | 3.82 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|