C20H18N2O6S — CID 6977586
dimethyl 2-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,4-dicarboxylate (PubChem CID 6977586) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is dimethyl 2-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 6977586 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | dimethyl 2-[(3R)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(N2C(=O)C[C@@H](Sc3ccccc3N)C2=O)c1 |
| InChI | InChI=1S/C20H18N2O6S/c1-27-19(25)11-7-8-12(20(26)28-2)14(9-11)22-17(23)10-16(18(22)24)29-15-6-4-3-5-13(15)21/h3-9,16H,10,21H2,1-2H3/t16-/m1/s1 |
| InChIKey | JBUMGMPTWCVYBT-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|