C25H19Cl2N3O5S — CID 99130136
[2-(2,4-dichloroanilino)-2-oxoethyl] 4-[(3S)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 99130136) has the molecular formula C25H19Cl2N3O5S and a molecular weight of 544.42 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 4-[(3S)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 4-[(3S)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 99130136 |
| Molecular Formula | C25H19Cl2N3O5S |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 4-[(3S)-3-(2-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1ccccc1S[C@H]1CC(=O)N(c2ccc(C(=O)OCC(=O)Nc3ccc(Cl)cc3Cl)cc2)C1=O |
| InChI | InChI=1S/C25H19Cl2N3O5S/c26-15-7-10-19(17(27)11-15)29-22(31)13-35-25(34)14-5-8-16(9-6-14)30-23(32)12-21(24(30)33)36-20-4-2-1-3-18(20)28/h1-11,21H,12-13,28H2,(H,29,31)/t21-/m0/s1 |
| InChIKey | BHGBQCCHSLBVPS-NRFANRHFSA-N |
| XLogP | 4.80 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|