C29H23N3O5S — CID 18893985
[2-(naphthalen-2-ylamino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 18893985) has the molecular formula C29H23N3O5S and a molecular weight of 525.59 g/mol. Its IUPAC name is [2-(naphthalen-2-ylamino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 18893985 |
| Molecular Formula | C29H23N3O5S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [2-(naphthalen-2-ylamino)-2-oxoethyl] 4-[3-(3-aminophenyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Nc1cccc(SC2CC(=O)N(c3ccc(C(=O)OCC(=O)Nc4ccc5ccccc5c4)cc3)C2=O)c1 |
| InChI | InChI=1S/C29H23N3O5S/c30-21-6-3-7-24(15-21)38-25-16-27(34)32(28(25)35)23-12-9-19(10-13-23)29(36)37-17-26(33)31-22-11-8-18-4-1-2-5-20(18)14-22/h1-15,25H,16-17,30H2,(H,31,33) |
| InChIKey | LHAMRQRSFREXCK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|