C25H19NO5S — CID 22781859
phenacyl 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate (PubChem CID 22781859) has the molecular formula C25H19NO5S and a molecular weight of 445.50 g/mol. Its IUPAC name is phenacyl 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate.
| Compound Name | phenacyl 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 22781859 |
| Molecular Formula | C25H19NO5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | phenacyl 4-(2,5-dioxo-3-phenylsulfanylpyrrolidin-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3ccccc3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H19NO5S/c27-21(17-7-3-1-4-8-17)16-31-25(30)18-11-13-19(14-12-18)26-23(28)15-22(24(26)29)32-20-9-5-2-6-10-20/h1-14,22H,15-16H2 |
| InChIKey | SZTALDSPVXHVGV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|