C28H19N5O5S — CID 21168833
phenacyl 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate (PubChem CID 21168833) has the molecular formula C28H19N5O5S and a molecular weight of 537.56 g/mol. Its IUPAC name is phenacyl 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate.
| Compound Name | phenacyl 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21168833 |
| Molecular Formula | C28H19N5O5S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | phenacyl 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3nnc4c(n3)[nH]c3ccccc34)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H19N5O5S/c34-21(16-6-2-1-3-7-16)15-38-27(37)17-10-12-18(13-11-17)33-23(35)14-22(26(33)36)39-28-30-25-24(31-32-28)19-8-4-5-9-20(19)29-25/h1-13,22H,14-15H2,(H,29,30,32) |
| InChIKey | DQYNDOWKRHSPBA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|