C34H23N5O5S — CID 21171810
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate (PubChem CID 21171810) has the molecular formula C34H23N5O5S and a molecular weight of 613.66 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21171810 |
| Molecular Formula | C34H23N5O5S |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2,5-dioxo-3-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)pyrrolidin-1-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3nnc4c(n3)[nH]c3ccccc34)C2=O)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H23N5O5S/c40-27(22-12-10-21(11-13-22)20-6-2-1-3-7-20)19-44-33(43)23-14-16-24(17-15-23)39-29(41)18-28(32(39)42)45-34-36-31-30(37-38-34)25-8-4-5-9-26(25)35-31/h1-17,28H,18-19H2,(H,35,36,38) |
| InChIKey | PBAUQQLJXGRRDB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|