C26H17Cl2NO7S — CID 21170024
2-[1-[4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]carbonylphenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid (PubChem CID 21170024) has the molecular formula C26H17Cl2NO7S and a molecular weight of 558.40 g/mol. Its IUPAC name is 2-[1-[4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]carbonylphenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid.
| Compound Name | 2-[1-[4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]carbonylphenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 21170024 |
| Molecular Formula | C26H17Cl2NO7S |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 557.01 |
| IUPAC Name | 2-[1-[4-[2-(3,4-dichlorophenyl)-2-oxoethoxy]carbonylphenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)CC(Sc3ccccc3C(=O)O)C2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H17Cl2NO7S/c27-18-10-7-15(11-19(18)28)20(30)13-36-26(35)14-5-8-16(9-6-14)29-23(31)12-22(24(29)32)37-21-4-2-1-3-17(21)25(33)34/h1-11,22H,12-13H2,(H,33,34) |
| InChIKey | BRXPFYRDDDIKBI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|