C40H29Cl2N3O8S — CID 21173273
[2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21173273) has the molecular formula C40H29Cl2N3O8S and a molecular weight of 782.66 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21173273 |
| Molecular Formula | C40H29Cl2N3O8S |
| Molecular Weight | 782.66 g/mol |
| Exact Mass | 781.11 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1cc(-c2cc(-c3ccccc3)nc(SC3CC(=O)N(c4ccc(C(=O)OCC(=O)c5ccc(Cl)c(Cl)c5)cc4)C3=O)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C40H29Cl2N3O8S/c1-50-33-16-25(17-34(51-2)37(33)52-3)27-18-31(22-7-5-4-6-8-22)44-38(28(27)20-43)54-35-19-36(47)45(39(35)48)26-12-9-23(10-13-26)40(49)53-21-32(46)24-11-14-29(41)30(42)15-24/h4-18,35H,19,21H2,1-3H3 |
| InChIKey | RCGQHWDHCLBJNX-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 145.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|