C41H33N3O9S — CID 21173222
[2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 21173222) has the molecular formula C41H33N3O9S and a molecular weight of 743.79 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 21173222 |
| Molecular Formula | C41H33N3O9S |
| Molecular Weight | 743.79 g/mol |
| Exact Mass | 743.19 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[3-[[3-cyano-6-phenyl-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1cccc(C(=O)COC(=O)c2ccc(N3C(=O)CC(Sc4nc(-c5ccccc5)cc(-c5cc(OC)c(OC)c(OC)c5)c4C#N)C3=O)cc2)c1 |
| InChI | InChI=1S/C41H33N3O9S/c1-49-29-12-8-11-26(17-29)33(45)23-53-41(48)25-13-15-28(16-14-25)44-37(46)21-36(40(44)47)54-39-31(22-42)30(20-32(43-39)24-9-6-5-7-10-24)27-18-34(50-2)38(52-4)35(19-27)51-3/h5-20,36H,21,23H2,1-4H3 |
| InChIKey | WYTIQHGOTUITAS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 154.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|