C18H11ClF3NO4S — CID 1347483
2-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid (PubChem CID 1347483) has the molecular formula C18H11ClF3NO4S and a molecular weight of 429.80 g/mol. Its IUPAC name is 2-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid.
| Compound Name | 2-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 1347483 |
| Molecular Formula | C18H11ClF3NO4S |
| Molecular Weight | 429.80 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1S[C@@H]1CC(=O)N(c2ccc(Cl)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H11ClF3NO4S/c19-12-6-5-9(7-11(12)18(20,21)22)23-15(24)8-14(16(23)25)28-13-4-2-1-3-10(13)17(26)27/h1-7,14H,8H2,(H,26,27)/t14-/m1/s1 |
| InChIKey | FCWWGUYLDIXRDR-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|