C24H17F3N2O3S — CID 5263445
2-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl-N-phenylbenzamide (PubChem CID 5263445) has the molecular formula C24H17F3N2O3S and a molecular weight of 470.47 g/mol. Its IUPAC name is 2-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl-N-phenylbenzamide.
| Compound Name | 2-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 5263445 |
| Molecular Formula | C24H17F3N2O3S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanyl-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1SC1CC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C24H17F3N2O3S/c25-24(26,27)15-7-6-10-17(13-15)29-21(30)14-20(23(29)32)33-19-12-5-4-11-18(19)22(31)28-16-8-2-1-3-9-16/h1-13,20H,14H2,(H,28,31) |
| InChIKey | VMMFZMRPJBORSN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|