C19H15F3N2O3S — CID 66488896
2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 66488896) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 66488896 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSC1CC(=O)N(c2ccccc2)C1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O3S/c20-19(21,22)12-5-4-6-13(9-12)23-16(25)11-28-15-10-17(26)24(18(15)27)14-7-2-1-3-8-14/h1-9,15H,10-11H2,(H,23,25) |
| InChIKey | TUEHFXMXFYFRPW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|