C25H19F3N2O3S — CID 5263435
2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 5263435) has the molecular formula C25H19F3N2O3S and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 5263435 |
| Molecular Formula | C25H19F3N2O3S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(N2C(=O)CC(Sc3ccccc3C(=O)Nc3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H19F3N2O3S/c1-15-9-11-18(12-10-15)30-22(31)14-21(24(30)33)34-20-8-3-2-7-19(20)23(32)29-17-6-4-5-16(13-17)25(26,27)28/h2-13,21H,14H2,1H3,(H,29,32) |
| InChIKey | DXFCJMTVHHWCEW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|