C18H11F3NO4S- — CID 6972963
2-[(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 6972963) has the molecular formula C18H11F3NO4S- and a molecular weight of 394.35 g/mol. Its IUPAC name is 2-[(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 6972963 |
| Molecular Formula | C18H11F3NO4S- |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 2-[(3R)-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | O=C([O-])c1ccccc1S[C@@H]1CC(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H12F3NO4S/c19-18(20,21)10-4-3-5-11(8-10)22-15(23)9-14(16(22)24)27-13-7-2-1-6-12(13)17(25)26/h1-8,14H,9H2,(H,25,26)/p-1/t14-/m1/s1 |
| InChIKey | UIAHBWHJZBKBPH-CQSZACIVSA-M |
| XLogP | 2.49 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|