C18H13INO4S- — CID 7902601
2-[(3R)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate (PubChem CID 7902601) has the molecular formula C18H13INO4S- and a molecular weight of 466.28 g/mol. Its IUPAC name is 2-[(3R)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate.
| Compound Name | 2-[(3R)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 7902601 |
| Molecular Formula | C18H13INO4S- |
| Molecular Weight | 466.28 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | 2-[(3R)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylbenzoate |
| SMILES | Cc1cc(I)ccc1N1C(=O)C[C@@H](Sc2ccccc2C(=O)[O-])C1=O |
| InChI | InChI=1S/C18H14INO4S/c1-10-8-11(19)6-7-13(10)20-16(21)9-15(17(20)22)25-14-5-3-2-4-12(14)18(23)24/h2-8,15H,9H2,1H3,(H,23,24)/p-1/t15-/m1/s1 |
| InChIKey | CMSXVEDJDZCPSR-OAHLLOKOSA-M |
| XLogP | 2.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|