C17H12IN2O4S- — CID 7902598
2-[(3S)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate (PubChem CID 7902598) has the molecular formula C17H12IN2O4S- and a molecular weight of 467.26 g/mol. Its IUPAC name is 2-[(3S)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[(3S)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 7902598 |
| Molecular Formula | C17H12IN2O4S- |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | 2-[(3S)-1-(4-iodo-2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
| SMILES | Cc1cc(I)ccc1N1C(=O)C[C@H](Sc2ncccc2C(=O)[O-])C1=O |
| InChI | InChI=1S/C17H13IN2O4S/c1-9-7-10(18)4-5-12(9)20-14(21)8-13(16(20)22)25-15-11(17(23)24)3-2-6-19-15/h2-7,13H,8H2,1H3,(H,23,24)/p-1/t13-/m0/s1 |
| InChIKey | GGOVAEHKPDHPJL-ZDUSSCGKSA-M |
| XLogP | 1.78 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|