C16H11N3O6S — CID 2225755
2-[(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 2225755) has the molecular formula C16H11N3O6S and a molecular weight of 373.35 g/mol. Its IUPAC name is 2-[(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 2225755 |
| Molecular Formula | C16H11N3O6S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1S[C@H]1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C16H11N3O6S/c20-13-8-12(26-14-11(16(22)23)5-2-6-17-14)15(21)18(13)9-3-1-4-10(7-9)19(24)25/h1-7,12H,8H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | SXGGDPZDAAMFHW-LBPRGKRZSA-N |
| XLogP | 2.11 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|