C20H18N3O5S- — CID 5054250
2-[1-(4-morpholin-4-ylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate (PubChem CID 5054250) has the molecular formula C20H18N3O5S- and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[1-(4-morpholin-4-ylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[1-(4-morpholin-4-ylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 5054250 |
| Molecular Formula | C20H18N3O5S- |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[1-(4-morpholin-4-ylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
| SMILES | O=C([O-])c1cccnc1SC1CC(=O)N(c2ccc(N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C20H19N3O5S/c24-17-12-16(29-18-15(20(26)27)2-1-7-21-18)19(25)23(17)14-5-3-13(4-6-14)22-8-10-28-11-9-22/h1-7,16H,8-12H2,(H,26,27)/p-1 |
| InChIKey | INMMAGGRCJKHTO-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|