C17H11F3N2O4S — CID 51469376
2-[(3S)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 51469376) has the molecular formula C17H11F3N2O4S and a molecular weight of 396.35 g/mol. Its IUPAC name is 2-[(3S)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[(3S)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 51469376 |
| Molecular Formula | C17H11F3N2O4S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[(3S)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1S[C@H]1CC(=O)N(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H11F3N2O4S/c18-17(19,20)9-3-5-10(6-4-9)22-13(23)8-12(15(22)24)27-14-11(16(25)26)2-1-7-21-14/h1-7,12H,8H2,(H,25,26)/t12-/m0/s1 |
| InChIKey | LEUBAPYIFRBKSG-LBPRGKRZSA-N |
| XLogP | 3.22 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|