C17H11N3O4S — CID 51469384
2-[(3R)-1-(2-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 51469384) has the molecular formula C17H11N3O4S and a molecular weight of 353.36 g/mol. Its IUPAC name is 2-[(3R)-1-(2-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[(3R)-1-(2-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 51469384 |
| Molecular Formula | C17H11N3O4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-[(3R)-1-(2-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | N#Cc1ccccc1N1C(=O)C[C@@H](Sc2ncccc2C(=O)O)C1=O |
| InChI | InChI=1S/C17H11N3O4S/c18-9-10-4-1-2-6-12(10)20-14(21)8-13(16(20)22)25-15-11(17(23)24)5-3-7-19-15/h1-7,13H,8H2,(H,23,24)/t13-/m1/s1 |
| InChIKey | MMWMFNWOMDJMKI-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|