C18H15N2O4S- — CID 2242167
2-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate (PubChem CID 2242167) has the molecular formula C18H15N2O4S- and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2242167 |
| Molecular Formula | C18H15N2O4S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
| SMILES | Cc1ccc(N2C(=O)C[C@H](Sc3ncccc3C(=O)[O-])C2=O)c(C)c1 |
| InChI | InChI=1S/C18H16N2O4S/c1-10-5-6-13(11(2)8-10)20-15(21)9-14(17(20)22)25-16-12(18(23)24)4-3-7-19-16/h3-8,14H,9H2,1-2H3,(H,23,24)/p-1/t14-/m0/s1 |
| InChIKey | BCDKCERGWIBYHV-AWEZNQCLSA-M |
| XLogP | 1.49 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|