C19H15N2O6S- — CID 3502219
2-[1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate (PubChem CID 3502219) has the molecular formula C19H15N2O6S- and a molecular weight of 399.40 g/mol. Its IUPAC name is 2-[1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 3502219 |
| Molecular Formula | C19H15N2O6S- |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-[1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)CC(Sc2ncccc2C(=O)[O-])C1=O |
| InChI | InChI=1S/C19H16N2O6S/c1-2-27-19(26)11-6-3-4-8-13(11)21-15(22)10-14(17(21)23)28-16-12(18(24)25)7-5-9-20-16/h3-9,14H,2,10H2,1H3,(H,24,25)/p-1 |
| InChIKey | QUUZCKSCDMZEDK-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 116.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|