C18H13N3O4S — CID 19058038
2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid (PubChem CID 19058038) has the molecular formula C18H13N3O4S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19058038 |
| Molecular Formula | C18H13N3O4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SC1CC(=O)N(c2ccc3cc[nH]c3c2)C1=O |
| InChI | InChI=1S/C18H13N3O4S/c22-15-9-14(26-16-12(18(24)25)2-1-6-20-16)17(23)21(15)11-4-3-10-5-7-19-13(10)8-11/h1-8,14,19H,9H2,(H,24,25) |
| InChIKey | BZIZWBVQJGNMCY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|