C25H16N6O2S — CID 19058492
2-amino-6-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 19058492) has the molecular formula C25H16N6O2S and a molecular weight of 464.51 g/mol. Its IUPAC name is 2-amino-6-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 19058492 |
| Molecular Formula | C25H16N6O2S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-amino-6-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SC2CC(=O)N(c3ccc4cc[nH]c4c3)C2=O)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C25H16N6O2S/c26-12-17-22(15-4-2-1-3-5-15)18(13-27)24(30-23(17)28)34-20-11-21(32)31(25(20)33)16-7-6-14-8-9-29-19(14)10-16/h1-10,20,29H,11H2,(H2,28,30) |
| InChIKey | SRYLIFCOAKBBFM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|