C23H20N4O2S — CID 19058486
2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 19058486) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 19058486 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[1-(1H-indol-6-yl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-methyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1CCc2nc(SC3CC(=O)N(c4ccc5cc[nH]c5c4)C3=O)c(C#N)cc2C1 |
| InChI | InChI=1S/C23H20N4O2S/c1-13-2-5-18-15(8-13)9-16(12-24)22(26-18)30-20-11-21(28)27(23(20)29)17-4-3-14-6-7-25-19(14)10-17/h3-4,6-7,9-10,13,20,25H,2,5,8,11H2,1H3 |
| InChIKey | XGBSPFDUZMQLRW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|