C23H15N5O2S — CID 1230355
2-amino-6-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 1230355) has the molecular formula C23H15N5O2S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-amino-6-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 1230355 |
| Molecular Formula | C23H15N5O2S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-amino-6-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanyl-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(S[C@@H]2CC(=O)N(c3ccccc3)C2=O)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C23H15N5O2S/c24-12-16-20(14-7-3-1-4-8-14)17(13-25)22(27-21(16)26)31-18-11-19(29)28(23(18)30)15-9-5-2-6-10-15/h1-10,18H,11H2,(H2,26,27)/t18-/m1/s1 |
| InChIKey | VCCZGEJFPUCZAZ-GOSISDBHSA-N |
| XLogP | 3.50 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|