C22H15N3O2S — CID 6737903
2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-6-phenylpyridine-3-carbonitrile (PubChem CID 6737903) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6737903 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanyl-6-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccccc2)nc1SC1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H15N3O2S/c23-14-16-11-12-18(15-7-3-1-4-8-15)24-21(16)28-19-13-20(26)25(22(19)27)17-9-5-2-6-10-17/h1-12,19H,13H2 |
| InChIKey | PIOOVTURXJVDQI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|