C23H17N3O2S — CID 4570698
2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-phenylpyridine-3-carbonitrile (PubChem CID 4570698) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4570698 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[1-(4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanyl-6-phenylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(N2C(=O)CC(Sc3nc(-c4ccccc4)ccc3C#N)C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-15-7-10-18(11-8-15)26-21(27)13-20(23(26)28)29-22-17(14-24)9-12-19(25-22)16-5-3-2-4-6-16/h2-12,20H,13H2,1H3 |
| InChIKey | YYWZLPXVRMVRKT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|